C32H30ClNO2S — CID 86631018
methyl 2-[3-[(R)-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-cyclopropylmethyl]sulfanylpropyl]benzoate (PubChem CID 86631018) has the molecular formula C32H30ClNO2S and a molecular weight of 528.12 g/mol. Its IUPAC name is methyl 2-[3-[(R)-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-cyclopropylmethyl]sulfanylpropyl]benzoate.
| Compound Name | methyl 2-[3-[(R)-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-cyclopropylmethyl]sulfanylpropyl]benzoate |
|---|---|
| PubChem CID | 86631018 |
| Molecular Formula | C32H30ClNO2S |
| Molecular Weight | 528.12 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | methyl 2-[3-[(R)-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-cyclopropylmethyl]sulfanylpropyl]benzoate |
| SMILES | COC(=O)c1ccccc1CCCS[C@@H](c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1)C1CC1 |
| InChI | InChI=1S/C32H30ClNO2S/c1-36-32(35)29-10-3-2-7-23(29)9-5-19-37-31(25-12-13-25)26-8-4-6-22(20-26)11-17-28-18-15-24-14-16-27(33)21-30(24)34-28/h2-4,6-8,10-11,14-18,20-21,25,31H,5,9,12-13,19H2,1H3/t31-/m1/s1 |
| InChIKey | TWBNAWWTVROQGN-WJOKGBTCSA-N |
| XLogP | 8.66 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.12 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|