About methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate
methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate (PubChem CID 68854399) has the molecular formula C28H26ClNO4
and a molecular weight of 475.97 g/mol. Its IUPAC name is methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate.
Molecular Properties
| Compound Name | methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate |
| PubChem CID | 68854399 |
| Molecular Formula | C28H26ClNO4 |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate |
| SMILES | COC(=O)c1cccc(CCCO)c1-c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1.O |
| InChI | InChI=1S/C28H24ClNO3.H2O/c1-33-28(32)25-9-3-6-21(8-4-16-31)27(25)22-7-2-5-19(17-22)10-14-24-15-12-20-11-13-23(29)18-26(20)30-24;/h2-3,5-7,9-15,17-18,31H,4,8,16H2,1H3;1H2 |
| InChIKey | BDBWROLBDGDLCP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate?
The IUPAC name of methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate (CID 68854399) is methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate.
What is the SMILES notation for methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate?
The canonical SMILES for methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate is COC(=O)c1cccc(CCCO)c1-c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1.O.
What is the InChIKey of methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate?
The InChIKey is BDBWROLBDGDLCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24ClNO3.H2O/c1-33-28(32)25-9-3-6-21(8-4-16-31)27(25)22-7-2-5-19(17-22)10-14-24-15-12-20-11-13-23(29)18-26(20)30-24;/h2-3,5-7,9-15,17-18,31H,4,8,16H2,1H3;1H2.
What are the key properties of methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate?
methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate has a molecular weight of 475.97 g/mol, XLogP of 5.61, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(3-hydroxypropyl)benzoate;hydrate is sourced from PubChem (CID 68854399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).