C30H28ClNO3S — CID 143462009
ethanethioic S-acid;methyl 2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]benzoate (PubChem CID 143462009) has the molecular formula C30H28ClNO3S and a molecular weight of 518.08 g/mol. Its IUPAC name is ethanethioic S-acid;methyl 2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]benzoate.
| Compound Name | ethanethioic S-acid;methyl 2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]benzoate |
|---|---|
| PubChem CID | 143462009 |
| Molecular Formula | C30H28ClNO3S |
| Molecular Weight | 518.08 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | ethanethioic S-acid;methyl 2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]benzoate |
| SMILES | CC(=O)S.COC(=O)c1ccccc1CCCc1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C28H24ClNO2.C2H4OS/c1-32-28(31)26-11-3-2-9-22(26)10-5-8-20-6-4-7-21(18-20)12-16-25-17-14-23-13-15-24(29)19-27(23)30-25;1-2(3)4/h2-4,6-7,9,11-19H,5,8,10H2,1H3;1H3,(H,3,4)/b16-12+; |
| InChIKey | WSXQEAKWEDOPIN-CLNHMMGSSA-N |
| XLogP | 7.48 |
| TPSA | 56.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.08 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|