C28H26ClNO3 — CID 143735269
methyl (E,6S)-6-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2,3-bis(ethenyl)-6-hydroxyhex-2-enoate (PubChem CID 143735269) has the molecular formula C28H26ClNO3 and a molecular weight of 459.97 g/mol. Its IUPAC name is methyl (E,6S)-6-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2,3-bis(ethenyl)-6-hydroxyhex-2-enoate.
| Compound Name | methyl (E,6S)-6-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2,3-bis(ethenyl)-6-hydroxyhex-2-enoate |
|---|---|
| PubChem CID | 143735269 |
| Molecular Formula | C28H26ClNO3 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | methyl (E,6S)-6-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2,3-bis(ethenyl)-6-hydroxyhex-2-enoate |
| SMILES | C=C/C(CC[C@H](O)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1)=C(\C=C)C(=O)OC |
| InChI | InChI=1S/C28H26ClNO3/c1-4-20(25(5-2)28(32)33-3)12-16-27(31)22-8-6-7-19(17-22)9-14-24-15-11-21-10-13-23(29)18-26(21)30-24/h4-11,13-15,17-18,27,31H,1-2,12,16H2,3H3/b14-9+,25-20-/t27-/m0/s1 |
| InChIKey | UWDLKVQPVSCCHJ-XXYMDKPFSA-N |
| XLogP | 6.71 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|