C29H28ClINO2P — CID 143647590
1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-iodophosphanyloxypropan-2-yl)phenyl]propan-1-ol (PubChem CID 143647590) has the molecular formula C29H28ClINO2P and a molecular weight of 615.88 g/mol. Its IUPAC name is 1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-iodophosphanyloxypropan-2-yl)phenyl]propan-1-ol.
| Compound Name | 1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-iodophosphanyloxypropan-2-yl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 143647590 |
| Molecular Formula | C29H28ClINO2P |
| Molecular Weight | 615.88 g/mol |
| Exact Mass | 615.06 |
| IUPAC Name | 1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-iodophosphanyloxypropan-2-yl)phenyl]propan-1-ol |
| SMILES | CC(C)(OPI)c1ccccc1CCC(O)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C29H28ClINO2P/c1-29(2,34-35-31)26-9-4-3-7-21(26)13-17-28(33)23-8-5-6-20(18-23)10-15-25-16-12-22-11-14-24(30)19-27(22)32-25/h3-12,14-16,18-19,28,33,35H,13,17H2,1-2H3/b15-10+ |
| InChIKey | FRDQLIVPHCZCGP-XNTDXEJSSA-N |
| XLogP | 8.92 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.88 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|