C29H28ClNOS — CID 173074317
(4R)-3-benzyl-4-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2-methyl-4-sulfanylbutan-2-ol (PubChem CID 173074317) has the molecular formula C29H28ClNOS and a molecular weight of 474.07 g/mol. Its IUPAC name is (4R)-3-benzyl-4-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2-methyl-4-sulfanylbutan-2-ol.
| Compound Name | (4R)-3-benzyl-4-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2-methyl-4-sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 173074317 |
| Molecular Formula | C29H28ClNOS |
| Molecular Weight | 474.07 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (4R)-3-benzyl-4-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2-methyl-4-sulfanylbutan-2-ol |
| SMILES | CC(C)(O)C(Cc1ccccc1)[C@@H](S)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C29H28ClNOS/c1-29(2,32)26(18-20-7-4-3-5-8-20)28(33)23-10-6-9-21(17-23)11-15-25-16-13-22-12-14-24(30)19-27(22)31-25/h3-17,19,26,28,32-33H,18H2,1-2H3/t26?,28-/m0/s1 |
| InChIKey | CGBVOZXIWVXHCR-RXBHZZDJSA-N |
| XLogP | 7.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.07 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|