C21H17ClNNaO3 — CID 23689561
sodium 4-[3-[(E)-2-(5-chloroquinolin-2-yl)ethenyl]phenoxy]butanoate (PubChem CID 23689561) has the molecular formula C21H17ClNNaO3 and a molecular weight of 389.81 g/mol. Its IUPAC name is sodium 4-[3-[(E)-2-(5-chloroquinolin-2-yl)ethenyl]phenoxy]butanoate.
| Compound Name | sodium 4-[3-[(E)-2-(5-chloroquinolin-2-yl)ethenyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 23689561 |
| Molecular Formula | C21H17ClNNaO3 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | sodium 4-[3-[(E)-2-(5-chloroquinolin-2-yl)ethenyl]phenoxy]butanoate |
| SMILES | O=C([O-])CCCOc1cccc(/C=C/c2ccc3c(Cl)cccc3n2)c1.[Na+] |
| InChI | InChI=1S/C21H18ClNO3.Na/c22-19-6-2-7-20-18(19)12-11-16(23-20)10-9-15-4-1-5-17(14-15)26-13-3-8-21(24)25;/h1-2,4-7,9-12,14H,3,8,13H2,(H,24,25);/q;+1/p-1/b10-9+; |
| InChIKey | MVUIWWCLCFWDLO-RRABGKBLSA-M |
| XLogP | 0.97 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|