C39H32ClN2O5S2- — CID 59095087
(1Z)-3-[2-[3-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenoxy]propoxy]phenyl]phenyl]-N-thiophen-2-ylsulfonylpropanimidate (PubChem CID 59095087) has the molecular formula C39H32ClN2O5S2- and a molecular weight of 708.28 g/mol. Its IUPAC name is (1Z)-3-[2-[3-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenoxy]propoxy]phenyl]phenyl]-N-thiophen-2-ylsulfonylpropanimidate.
| Compound Name | (1Z)-3-[2-[3-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenoxy]propoxy]phenyl]phenyl]-N-thiophen-2-ylsulfonylpropanimidate |
|---|---|
| PubChem CID | 59095087 |
| Molecular Formula | C39H32ClN2O5S2- |
| Molecular Weight | 708.28 g/mol |
| Exact Mass | 707.14 |
| IUPAC Name | (1Z)-3-[2-[3-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenoxy]propoxy]phenyl]phenyl]-N-thiophen-2-ylsulfonylpropanimidate |
| SMILES | O=S(=O)(/N=C(\[O-])CCc1ccccc1-c1cccc(OCCCOc2cccc(/C=C/c3ccc4ccc(Cl)cc4n3)c2)c1)c1cccs1 |
| InChI | InChI=1S/C39H33ClN2O5S2/c40-32-18-15-30-16-20-33(41-37(30)27-32)19-14-28-7-3-10-34(25-28)46-22-6-23-47-35-11-4-9-31(26-35)36-12-2-1-8-29(36)17-21-38(43)42-49(44,45)39-13-5-24-48-39/h1-5,7-16,18-20,24-27H,6,17,21-23H2,(H,42,43)/p-1/b19-14+ |
| InChIKey | WJQJLWYTNOQICH-XMHGGMMESA-M |
| XLogP | 8.72 |
| TPSA | 100.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.28 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|