C33H30N2O3S2 — CID 142092812
ethane;(E)-3-[2-[3-[(E)-2-(7-methylquinolin-2-yl)ethenyl]phenyl]phenyl]-N-thiophen-2-ylsulfonylprop-2-enamide (PubChem CID 142092812) has the molecular formula C33H30N2O3S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is ethane;(E)-3-[2-[3-[(E)-2-(7-methylquinolin-2-yl)ethenyl]phenyl]phenyl]-N-thiophen-2-ylsulfonylprop-2-enamide.
| Compound Name | ethane;(E)-3-[2-[3-[(E)-2-(7-methylquinolin-2-yl)ethenyl]phenyl]phenyl]-N-thiophen-2-ylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 142092812 |
| Molecular Formula | C33H30N2O3S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | ethane;(E)-3-[2-[3-[(E)-2-(7-methylquinolin-2-yl)ethenyl]phenyl]phenyl]-N-thiophen-2-ylsulfonylprop-2-enamide |
| SMILES | CC.Cc1ccc2ccc(/C=C/c3cccc(-c4ccccc4/C=C/C(=O)NS(=O)(=O)c4cccs4)c3)nc2c1 |
| InChI | InChI=1S/C31H24N2O3S2.C2H6/c1-22-11-13-25-14-17-27(32-29(25)20-22)16-12-23-6-4-8-26(21-23)28-9-3-2-7-24(28)15-18-30(34)33-38(35,36)31-10-5-19-37-31;1-2/h2-21H,1H3,(H,33,34);1-2H3/b16-12+,18-15+; |
| InChIKey | VQOPZVJHPJPGPC-INZRPNHBSA-N |
| XLogP | 7.99 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|