C26H18N2O5S2 — CID 46885653
(E)-3-[1-(naphthalen-2-ylmethyl)-2,3-dioxoindol-7-yl]-N-thiophen-2-ylsulfonylprop-2-enamide (PubChem CID 46885653) has the molecular formula C26H18N2O5S2 and a molecular weight of 502.57 g/mol. Its IUPAC name is (E)-3-[1-(naphthalen-2-ylmethyl)-2,3-dioxoindol-7-yl]-N-thiophen-2-ylsulfonylprop-2-enamide.
| Compound Name | (E)-3-[1-(naphthalen-2-ylmethyl)-2,3-dioxoindol-7-yl]-N-thiophen-2-ylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 46885653 |
| Molecular Formula | C26H18N2O5S2 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | (E)-3-[1-(naphthalen-2-ylmethyl)-2,3-dioxoindol-7-yl]-N-thiophen-2-ylsulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2c1N(Cc1ccc3ccccc3c1)C(=O)C2=O)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C26H18N2O5S2/c29-22(27-35(32,33)23-9-4-14-34-23)13-12-19-7-3-8-21-24(19)28(26(31)25(21)30)16-17-10-11-18-5-1-2-6-20(18)15-17/h1-15H,16H2,(H,27,29)/b13-12+ |
| InChIKey | QIJXURVARCDFAT-OUKQBFOZSA-N |
| XLogP | 4.15 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|