C29H20ClFNNaO2S — CID 69409958
sodium 3-[[5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]propanoate (PubChem CID 69409958) has the molecular formula C29H20ClFNNaO2S and a molecular weight of 523.99 g/mol. Its IUPAC name is sodium 3-[[5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]propanoate.
| Compound Name | sodium 3-[[5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 69409958 |
| Molecular Formula | C29H20ClFNNaO2S |
| Molecular Weight | 523.99 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | sodium 3-[[5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]propanoate |
| SMILES | O=C([O-])CCSC1c2ccccc2C=Cc2ccc(C=Cc3ccc4cc(F)c(Cl)cc4n3)cc21.[Na+] |
| InChI | InChI=1S/C29H21ClFNO2S.Na/c30-25-17-27-21(16-26(25)31)10-12-22(32-27)11-6-18-5-7-20-9-8-19-3-1-2-4-23(19)29(24(20)15-18)35-14-13-28(33)34;/h1-12,15-17,29H,13-14H2,(H,33,34);/q;+1/p-1 |
| InChIKey | SQXVBAMMKFWMPS-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.99 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|