C29H20Cl2FNO2S — CID 69410392
3-[[12-chloro-5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]sulfanyl]propanoic acid (PubChem CID 69410392) has the molecular formula C29H20Cl2FNO2S and a molecular weight of 536.46 g/mol. Its IUPAC name is 3-[[12-chloro-5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]sulfanyl]propanoic acid.
| Compound Name | 3-[[12-chloro-5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 69410392 |
| Molecular Formula | C29H20Cl2FNO2S |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 3-[[12-chloro-5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl]sulfanyl]propanoic acid |
| SMILES | O=C(O)CCSC1c2cc(C=Cc3ccc4cc(F)c(Cl)cc4n3)ccc2C=Cc2c(Cl)cccc21 |
| InChI | InChI=1S/C29H20Cl2FNO2S/c30-24-3-1-2-22-21(24)11-8-18-6-4-17(14-23(18)29(22)36-13-12-28(34)35)5-9-20-10-7-19-15-26(32)25(31)16-27(19)33-20/h1-11,14-16,29H,12-13H2,(H,34,35) |
| InChIKey | WJCXDRWWUUNXIZ-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|