C29H21ClNNaO2S — CID 69410797
sodium 3-[[5-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]propanoate (PubChem CID 69410797) has the molecular formula C29H21ClNNaO2S and a molecular weight of 506.00 g/mol. Its IUPAC name is sodium 3-[[5-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]propanoate.
| Compound Name | sodium 3-[[5-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 69410797 |
| Molecular Formula | C29H21ClNNaO2S |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | sodium 3-[[5-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]propanoate |
| SMILES | O=C([O-])CCSC1c2ccccc2C=Cc2ccc(/C=C/c3ccc4ccc(Cl)cc4n3)cc21.[Na+] |
| InChI | InChI=1S/C29H22ClNO2S.Na/c30-23-12-10-22-11-14-24(31-27(22)18-23)13-6-19-5-7-21-9-8-20-3-1-2-4-25(20)29(26(21)17-19)34-16-15-28(32)33;/h1-14,17-18,29H,15-16H2,(H,32,33);/q;+1/p-1/b13-6+; |
| InChIKey | ZMNPQFOTTIVWOF-AWFSDRIXSA-M |
| XLogP | 3.51 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|