C30H23F2NO2S — CID 69410912
(2S)-3-[[5-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]-2-methylpropanoic acid (PubChem CID 69410912) has the molecular formula C30H23F2NO2S and a molecular weight of 499.58 g/mol. Its IUPAC name is (2S)-3-[[5-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[[5-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 69410912 |
| Molecular Formula | C30H23F2NO2S |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (2S)-3-[[5-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]sulfanyl]-2-methylpropanoic acid |
| SMILES | C[C@H](CSC1c2ccccc2C=Cc2ccc(/C=C/c3ccc4cc(F)c(F)cc4n3)cc21)C(=O)O |
| InChI | InChI=1S/C30H23F2NO2S/c1-18(30(34)35)17-36-29-24-5-3-2-4-20(24)9-10-21-8-6-19(14-25(21)29)7-12-23-13-11-22-15-26(31)27(32)16-28(22)33-23/h2-16,18,29H,17H2,1H3,(H,34,35)/b12-7+/t18-,29?/m1/s1 |
| InChIKey | XDHFARIIBABNKT-ROAKRKJLSA-N |
| XLogP | 7.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|