C33H33BrN2O4S2 — CID 54191694
5-[3-[3-[2-(7-bromoquinolin-2-yl)ethenyl]phenoxy]phenyl]-4-[[3-(dimethylamino)-3-oxopropyl]disulfanyl]pentanoic acid (PubChem CID 54191694) has the molecular formula C33H33BrN2O4S2 and a molecular weight of 665.68 g/mol. Its IUPAC name is 5-[3-[3-[2-(7-bromoquinolin-2-yl)ethenyl]phenoxy]phenyl]-4-[[3-(dimethylamino)-3-oxopropyl]disulfanyl]pentanoic acid.
| Compound Name | 5-[3-[3-[2-(7-bromoquinolin-2-yl)ethenyl]phenoxy]phenyl]-4-[[3-(dimethylamino)-3-oxopropyl]disulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 54191694 |
| Molecular Formula | C33H33BrN2O4S2 |
| Molecular Weight | 665.68 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | 5-[3-[3-[2-(7-bromoquinolin-2-yl)ethenyl]phenoxy]phenyl]-4-[[3-(dimethylamino)-3-oxopropyl]disulfanyl]pentanoic acid |
| SMILES | CN(C)C(=O)CCSSC(CCC(=O)O)Cc1cccc(Oc2cccc(C=Cc3ccc4ccc(Br)cc4n3)c2)c1 |
| InChI | InChI=1S/C33H33BrN2O4S2/c1-36(2)32(37)17-18-41-42-30(15-16-33(38)39)21-24-6-4-8-29(20-24)40-28-7-3-5-23(19-28)9-13-27-14-11-25-10-12-26(34)22-31(25)35-27/h3-14,19-20,22,30H,15-18,21H2,1-2H3,(H,38,39) |
| InChIKey | PIYLTKGZIBACMZ-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.68 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|