C31H49N5O4SSi — CID 162506824
(R)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-7-oxononyl]-2-methylpropane-2-sulfinamide (PubChem CID 162506824) has the molecular formula C31H49N5O4SSi and a molecular weight of 615.92 g/mol. Its IUPAC name is (R)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-7-oxononyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-7-oxononyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162506824 |
| Molecular Formula | C31H49N5O4SSi |
| Molecular Weight | 615.92 g/mol |
| Exact Mass | 615.33 |
| IUPAC Name | (R)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-7-oxononyl]-2-methylpropane-2-sulfinamide |
| SMILES | CCC(=O)CCCCC[C@H](N[S@](=O)C(C)(C)C)c1nc(-c2cc3ccccc3nc2OC)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C31H49N5O4SSi/c1-9-24(37)16-11-10-12-18-27(35-41(38)31(2,3)4)29-33-28(34-36(29)22-40-19-20-42(6,7)8)25-21-23-15-13-14-17-26(23)32-30(25)39-5/h13-15,17,21,27,35H,9-12,16,18-20,22H2,1-8H3/t27-,41+/m0/s1 |
| InChIKey | HNVDWFFZSIEACS-AVCSGNNYSA-N |
| XLogP | 6.84 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.92 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|