C29H44N4O4 — CID 154649154
hexane;6-[2-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]ethoxy]hexan-3-one;N-methylformamide (PubChem CID 154649154) has the molecular formula C29H44N4O4 and a molecular weight of 512.70 g/mol. Its IUPAC name is hexane;6-[2-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]ethoxy]hexan-3-one;N-methylformamide.
| Compound Name | hexane;6-[2-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]ethoxy]hexan-3-one;N-methylformamide |
|---|---|
| PubChem CID | 154649154 |
| Molecular Formula | C29H44N4O4 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | hexane;6-[2-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]ethoxy]hexan-3-one;N-methylformamide |
| SMILES | CCC(=O)CCCOCCc1ncc(-c2cc3ccccc3nc2OC)[nH]1.CCCCCC.CNC=O |
| InChI | InChI=1S/C21H25N3O3.C6H14.C2H5NO/c1-3-16(25)8-6-11-27-12-10-20-22-14-19(23-20)17-13-15-7-4-5-9-18(15)24-21(17)26-2;1-3-5-6-4-2;1-3-2-4/h4-5,7,9,13-14H,3,6,8,10-12H2,1-2H3,(H,22,23);3-6H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | BXILSNYBLOICBY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|