C29H40N6O3 — CID 130373668
(7S)-7-[[1-azabicyclo[2.2.2]octan-4-yl(hydroxy)methyl]amino]-7-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-N-methylheptanamide (PubChem CID 130373668) has the molecular formula C29H40N6O3 and a molecular weight of 520.68 g/mol. Its IUPAC name is (7S)-7-[[1-azabicyclo[2.2.2]octan-4-yl(hydroxy)methyl]amino]-7-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-N-methylheptanamide.
| Compound Name | (7S)-7-[[1-azabicyclo[2.2.2]octan-4-yl(hydroxy)methyl]amino]-7-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-N-methylheptanamide |
|---|---|
| PubChem CID | 130373668 |
| Molecular Formula | C29H40N6O3 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | (7S)-7-[[1-azabicyclo[2.2.2]octan-4-yl(hydroxy)methyl]amino]-7-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-N-methylheptanamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(O)C12CCN(CC1)CC2)c1ncc(-c2cc3ccccc3nc2OC)[nH]1 |
| InChI | InChI=1S/C29H40N6O3/c1-30-25(36)11-5-3-4-10-23(34-28(37)29-12-15-35(16-13-29)17-14-29)26-31-19-24(32-26)21-18-20-8-6-7-9-22(20)33-27(21)38-2/h6-9,18-19,23,28,34,37H,3-5,10-17H2,1-2H3,(H,30,36)(H,31,32)/t23-,28?/m0/s1 |
| InChIKey | YOBZLHHHGLSTKP-UHFKCPIBSA-N |
| XLogP | 3.77 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|