C23H28N4O3 — CID 166912612
N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-oxononyl]formamide (PubChem CID 166912612) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-oxononyl]formamide.
| Compound Name | N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-oxononyl]formamide |
|---|---|
| PubChem CID | 166912612 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-oxononyl]formamide |
| SMILES | CCC(=O)CCCCC[C@H](NC=O)c1ncc(-c2cc3ccccc3nc2OC)[nH]1 |
| InChI | InChI=1S/C23H28N4O3/c1-3-17(29)10-5-4-6-12-20(25-15-28)22-24-14-21(26-22)18-13-16-9-7-8-11-19(16)27-23(18)30-2/h7-9,11,13-15,20H,3-6,10,12H2,1-2H3,(H,24,26)(H,25,28)/t20-/m0/s1 |
| InChIKey | MKTUYOPXSJULSW-FQEVSTJZSA-N |
| XLogP | 4.35 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|