C29H37N5O4 — CID 154649113
N-[1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-2-(4-oxohexoxy)ethyl]-1-azabicyclo[2.2.2]octane-4-carboxamide (PubChem CID 154649113) has the molecular formula C29H37N5O4 and a molecular weight of 519.65 g/mol. Its IUPAC name is N-[1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-2-(4-oxohexoxy)ethyl]-1-azabicyclo[2.2.2]octane-4-carboxamide.
| Compound Name | N-[1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-2-(4-oxohexoxy)ethyl]-1-azabicyclo[2.2.2]octane-4-carboxamide |
|---|---|
| PubChem CID | 154649113 |
| Molecular Formula | C29H37N5O4 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | N-[1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-2-(4-oxohexoxy)ethyl]-1-azabicyclo[2.2.2]octane-4-carboxamide |
| SMILES | CCC(=O)CCCOCC(NC(=O)C12CCN(CC1)CC2)c1ncc(-c2cc3ccccc3nc2OC)[nH]1 |
| InChI | InChI=1S/C29H37N5O4/c1-3-21(35)8-6-16-38-19-25(33-28(36)29-10-13-34(14-11-29)15-12-29)26-30-18-24(31-26)22-17-20-7-4-5-9-23(20)32-27(22)37-2/h4-5,7,9,17-18,25H,3,6,8,10-16,19H2,1-2H3,(H,30,31)(H,33,36) |
| InChIKey | CVKQJXHPXGFLMG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|