C27H38N6O4 — CID 144568126
2-[amino-[(Z)-2-aminoethenyl]amino]-N-methylacetamide;9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one (PubChem CID 144568126) has the molecular formula C27H38N6O4 and a molecular weight of 510.64 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-aminoethenyl]amino]-N-methylacetamide;9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one.
| Compound Name | 2-[amino-[(Z)-2-aminoethenyl]amino]-N-methylacetamide;9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one |
|---|---|
| PubChem CID | 144568126 |
| Molecular Formula | C27H38N6O4 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | 2-[amino-[(Z)-2-aminoethenyl]amino]-N-methylacetamide;9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one |
| SMILES | CCC(=O)CCCCCCc1ncc(-c2cc3ccccc3nc2OC)o1.CNC(=O)CN(N)/C=C\N |
| InChI | InChI=1S/C22H26N2O3.C5H12N4O/c1-3-17(25)11-6-4-5-7-13-21-23-15-20(27-21)18-14-16-10-8-9-12-19(16)24-22(18)26-2;1-8-5(10)4-9(7)3-2-6/h8-10,12,14-15H,3-7,11,13H2,1-2H3;2-3H,4,6-7H2,1H3,(H,8,10)/b;3-2- |
| InChIKey | QZYIMCHIWLJTAS-AHNKWOMYSA-N |
| XLogP | 3.71 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|