C29H42N4O4 — CID 144568149
2-[(dimethylamino)methyl]butanamide;9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one (PubChem CID 144568149) has the molecular formula C29H42N4O4 and a molecular weight of 510.68 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]butanamide;9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one.
| Compound Name | 2-[(dimethylamino)methyl]butanamide;9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one |
|---|---|
| PubChem CID | 144568149 |
| Molecular Formula | C29H42N4O4 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | 2-[(dimethylamino)methyl]butanamide;9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one |
| SMILES | CCC(=O)CCCCCCc1ncc(-c2cc3ccccc3nc2OC)o1.CCC(CN(C)C)C(N)=O |
| InChI | InChI=1S/C22H26N2O3.C7H16N2O/c1-3-17(25)11-6-4-5-7-13-21-23-15-20(27-21)18-14-16-10-8-9-12-19(16)24-22(18)26-2;1-4-6(7(8)10)5-9(2)3/h8-10,12,14-15H,3-7,11,13H2,1-2H3;6H,4-5H2,1-3H3,(H2,8,10) |
| InChIKey | YHUSPXMRFZZFAH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|