C33H37N5O5 — CID 73057225
2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1,3,4-oxadiazol-2-yl]-7-oxononyl]acetamide (PubChem CID 73057225) has the molecular formula C33H37N5O5 and a molecular weight of 583.69 g/mol. Its IUPAC name is 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1,3,4-oxadiazol-2-yl]-7-oxononyl]acetamide.
| Compound Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1,3,4-oxadiazol-2-yl]-7-oxononyl]acetamide |
|---|---|
| PubChem CID | 73057225 |
| Molecular Formula | C33H37N5O5 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1,3,4-oxadiazol-2-yl]-7-oxononyl]acetamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)Cc1c(C)[nH]c2ccc(OC)cc12)c1nnc(-c2cc3ccccc3nc2OC)o1 |
| InChI | InChI=1S/C33H37N5O5/c1-5-22(39)12-7-6-8-14-29(35-30(40)19-24-20(2)34-28-16-15-23(41-3)18-25(24)28)33-38-37-32(43-33)26-17-21-11-9-10-13-27(21)36-31(26)42-4/h9-11,13,15-18,29,34H,5-8,12,14,19H2,1-4H3,(H,35,40)/t29-/m0/s1 |
| InChIKey | YVHDVCKFZBZYII-LJAQVGFWSA-N |
| XLogP | 6.42 |
| TPSA | 132.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|