C30H37N5O3 — CID 87332183
N-[(1S)-1-[5-(3-aminophenyl)-1H-imidazol-2-yl]-7-oxononyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 87332183) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is N-[(1S)-1-[5-(3-aminophenyl)-1H-imidazol-2-yl]-7-oxononyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(1S)-1-[5-(3-aminophenyl)-1H-imidazol-2-yl]-7-oxononyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 87332183 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | N-[(1S)-1-[5-(3-aminophenyl)-1H-imidazol-2-yl]-7-oxononyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)Cc1c(C)[nH]c2ccc(OC)cc12)c1ncc(-c2cccc(N)c2)[nH]1 |
| InChI | InChI=1S/C30H37N5O3/c1-4-22(36)11-6-5-7-12-27(30-32-18-28(35-30)20-9-8-10-21(31)15-20)34-29(37)17-24-19(2)33-26-14-13-23(38-3)16-25(24)26/h8-10,13-16,18,27,33H,4-7,11-12,17,31H2,1-3H3,(H,32,35)(H,34,37)/t27-/m0/s1 |
| InChIKey | FDGKPBQJGIANMG-MHZLTWQESA-N |
| XLogP | 5.79 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|