C33H36F6N4O5 — CID 171928638
2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]nonyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 171928638) has the molecular formula C33H36F6N4O5 and a molecular weight of 682.66 g/mol. Its IUPAC name is 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]nonyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]nonyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171928638 |
| Molecular Formula | C33H36F6N4O5 |
| Molecular Weight | 682.66 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]nonyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)Cc1c(C)[nH]c2ccc(OC)cc12)c1ncc(-c2cccc(C(F)(F)F)c2)[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H35F3N4O3.C2HF3O2/c1-4-22(39)11-6-5-7-12-27(30-35-18-28(38-30)20-9-8-10-21(15-20)31(32,33)34)37-29(40)17-24-19(2)36-26-14-13-23(41-3)16-25(24)26;3-2(4,5)1(6)7/h8-10,13-16,18,27,36H,4-7,11-12,17H2,1-3H3,(H,35,38)(H,37,40);(H,6,7)/t27-;/m0./s1 |
| InChIKey | JOPMSHQNIDRLEC-YCBFMBTMSA-N |
| XLogP | 7.86 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|