C40H41F3N6O5 — CID 171930200
(7S)-N-(2-aminophenyl)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide;2,2,2-trifluoroacetic acid (PubChem CID 171930200) has the molecular formula C40H41F3N6O5 and a molecular weight of 742.80 g/mol. Its IUPAC name is (7S)-N-(2-aminophenyl)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (7S)-N-(2-aminophenyl)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171930200 |
| Molecular Formula | C40H41F3N6O5 |
| Molecular Weight | 742.80 g/mol |
| Exact Mass | 742.31 |
| IUPAC Name | (7S)-N-(2-aminophenyl)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(=O)Nc3ccccc3N)c3ncc(-c4ccc5ccccc5c4)[nH]3)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C38H40N6O3.C2HF3O2/c1-24-29(30-21-28(47-2)18-19-32(30)41-24)22-37(46)43-34(14-4-3-5-15-36(45)42-33-13-9-8-12-31(33)39)38-40-23-35(44-38)27-17-16-25-10-6-7-11-26(25)20-27;3-2(4,5)1(6)7/h6-13,16-21,23,34,41H,3-5,14-15,22,39H2,1-2H3,(H,40,44)(H,42,45)(H,43,46);(H,6,7)/t34-;/m0./s1 |
| InChIKey | BTZFZZNCYONPCS-GXUZKUJRSA-N |
| XLogP | 8.23 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.80 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|