C37H45F6N5O7 — CID 171932499
N-[(1S)-1-[5-[4-[(dimethylamino)methyl]phenyl]-1H-imidazol-2-yl]-7-oxononyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171932499) has the molecular formula C37H45F6N5O7 and a molecular weight of 785.78 g/mol. Its IUPAC name is N-[(1S)-1-[5-[4-[(dimethylamino)methyl]phenyl]-1H-imidazol-2-yl]-7-oxononyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[(1S)-1-[5-[4-[(dimethylamino)methyl]phenyl]-1H-imidazol-2-yl]-7-oxononyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171932499 |
| Molecular Formula | C37H45F6N5O7 |
| Molecular Weight | 785.78 g/mol |
| Exact Mass | 785.32 |
| IUPAC Name | N-[(1S)-1-[5-[4-[(dimethylamino)methyl]phenyl]-1H-imidazol-2-yl]-7-oxononyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)Cc1c(C)[nH]c2ccc(OC)cc12)c1ncc(-c2ccc(CN(C)C)cc2)[nH]1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H43N5O3.2C2HF3O2/c1-6-25(39)10-8-7-9-11-30(33-34-20-31(37-33)24-14-12-23(13-15-24)21-38(3)4)36-32(40)19-27-22(2)35-29-17-16-26(41-5)18-28(27)29;2*3-2(4,5)1(6)7/h12-18,20,30,35H,6-11,19,21H2,1-5H3,(H,34,37)(H,36,40);2*(H,6,7)/t30-;;/m0../s1 |
| InChIKey | QYGJQIBHFLJFSC-ARIINYJRSA-N |
| XLogP | 7.53 |
| TPSA | 177.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.78 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|