C33H39F3N4O4 — CID 171928550
2-(2-ethyl-5-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 171928550) has the molecular formula C33H39F3N4O4 and a molecular weight of 612.69 g/mol. Its IUPAC name is 2-(2-ethyl-5-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2-ethyl-5-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171928550 |
| Molecular Formula | C33H39F3N4O4 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | 2-(2-ethyl-5-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)Cc1c(CC)[nH]c2ccc(C)cc12)c1ncc(-c2ccccc2)[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H38N4O2.C2HF3O2/c1-4-23(36)14-10-7-11-15-28(31-32-20-29(35-31)22-12-8-6-9-13-22)34-30(37)19-25-24-18-21(3)16-17-27(24)33-26(25)5-2;3-2(4,5)1(6)7/h6,8-9,12-13,16-18,20,28,33H,4-5,7,10-11,14-15,19H2,1-3H3,(H,32,35)(H,34,37);(H,6,7)/t28-;/m0./s1 |
| InChIKey | SAFISZXKLVLNGU-JCOPYZAKSA-N |
| XLogP | 7.39 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|