C27H33F3N4O4 — CID 171928698
1,1-dimethyl-3-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 171928698) has the molecular formula C27H33F3N4O4 and a molecular weight of 534.58 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1,1-dimethyl-3-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171928698 |
| Molecular Formula | C27H33F3N4O4 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 1,1-dimethyl-3-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)N(C)C)c1ncc(-c2ccc3ccccc3c2)[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H32N4O2.C2HF3O2/c1-4-21(30)12-6-5-7-13-22(28-25(31)29(2)3)24-26-17-23(27-24)20-15-14-18-10-8-9-11-19(18)16-20;3-2(4,5)1(6)7/h8-11,14-17,22H,4-7,12-13H2,1-3H3,(H,26,27)(H,28,31);(H,6,7)/t22-;/m0./s1 |
| InChIKey | MSKBYNPVZJTPHJ-FTBISJDPSA-N |
| XLogP | 6.11 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|