C31H36F6N4O6 — CID 171928322
1-methyl-N-[(1R)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]azetidine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171928322) has the molecular formula C31H36F6N4O6 and a molecular weight of 674.64 g/mol. Its IUPAC name is 1-methyl-N-[(1R)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]azetidine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-methyl-N-[(1R)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]azetidine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171928322 |
| Molecular Formula | C31H36F6N4O6 |
| Molecular Weight | 674.64 g/mol |
| Exact Mass | 674.25 |
| IUPAC Name | 1-methyl-N-[(1R)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]azetidine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCC(=O)CCCCC[C@@H](NC(=O)C1CN(C)C1)c1ncc(-c2ccc3ccccc3c2)[nH]1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H34N4O2.2C2HF3O2/c1-3-23(32)11-5-4-6-12-24(30-27(33)22-17-31(2)18-22)26-28-16-25(29-26)21-14-13-19-9-7-8-10-20(19)15-21;2*3-2(4,5)1(6)7/h7-10,13-16,22,24H,3-6,11-12,17-18H2,1-2H3,(H,28,29)(H,30,33);2*(H,6,7)/t24-;;/m1../s1 |
| InChIKey | TUJFLSUOLFRWSZ-PPLJNSMQSA-N |
| XLogP | 6.14 |
| TPSA | 152.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|