C29H39N5O3 — CID 87332187
N-[(1S)-7-[methoxy(methyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1-methylpiperidine-4-carboxamide (PubChem CID 87332187) has the molecular formula C29H39N5O3 and a molecular weight of 505.66 g/mol. Its IUPAC name is N-[(1S)-7-[methoxy(methyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[(1S)-7-[methoxy(methyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 87332187 |
| Molecular Formula | C29H39N5O3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | N-[(1S)-7-[methoxy(methyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CON(C)C(=O)CCCCC[C@H](NC(=O)C1CCN(C)CC1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C29H39N5O3/c1-33-17-15-22(16-18-33)29(36)32-25(11-5-4-6-12-27(35)34(2)37-3)28-30-20-26(31-28)24-14-13-21-9-7-8-10-23(21)19-24/h7-10,13-14,19-20,22,25H,4-6,11-12,15-18H2,1-3H3,(H,30,31)(H,32,36)/t25-/m0/s1 |
| InChIKey | AEQPPDVWBLMWLL-VWLOTQADSA-N |
| XLogP | 4.70 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|