C24H33FN4O2 — CID 44589632
N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxooctyl]-1-methylpiperidine-4-carboxamide (PubChem CID 44589632) has the molecular formula C24H33FN4O2 and a molecular weight of 428.55 g/mol. Its IUPAC name is N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxooctyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxooctyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 44589632 |
| Molecular Formula | C24H33FN4O2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxooctyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C1CCN(C)CC1)c1ncc(-c2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C24H33FN4O2/c1-17(30)6-4-3-5-7-21(28-24(31)19-12-14-29(2)15-13-19)23-26-16-22(27-23)18-8-10-20(25)11-9-18/h8-11,16,19,21H,3-7,12-15H2,1-2H3,(H,26,27)(H,28,31)/t21-/m0/s1 |
| InChIKey | YYZOAJKFLKRZAZ-NRFANRHFSA-N |
| XLogP | 4.25 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|