C27H35N5O2 — CID 118453130
1-methyl-N-[(1S)-7-(methylamino)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]pyrrolidine-3-carboxamide (PubChem CID 118453130) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-7-(methylamino)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-methyl-N-[(1S)-7-(methylamino)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118453130 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 1-methyl-N-[(1S)-7-(methylamino)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]pyrrolidine-3-carboxamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)C1CCN(C)C1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C27H35N5O2/c1-28-25(33)11-5-3-4-10-23(31-27(34)22-14-15-32(2)18-22)26-29-17-24(30-26)21-13-12-19-8-6-7-9-20(19)16-21/h6-9,12-13,16-17,22-23H,3-5,10-11,14-15,18H2,1-2H3,(H,28,33)(H,29,30)(H,31,34)/t22?,23-/m0/s1 |
| InChIKey | JZQLZONYLZXVRN-WCSIJFPASA-N |
| XLogP | 4.04 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|