C32H34N6O2 — CID 90149122
5-methyl-N-[(1S)-7-(methylamino)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 90149122) has the molecular formula C32H34N6O2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 5-methyl-N-[(1S)-7-(methylamino)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[(1S)-7-(methylamino)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90149122 |
| Molecular Formula | C32H34N6O2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 5-methyl-N-[(1S)-7-(methylamino)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)c1cc(C)n(-c2ccccc2)n1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C32H34N6O2/c1-22-19-28(37-38(22)26-13-5-3-6-14-26)32(40)36-27(15-7-4-8-16-30(39)33-2)31-34-21-29(35-31)25-18-17-23-11-9-10-12-24(23)20-25/h3,5-6,9-14,17-21,27H,4,7-8,15-16H2,1-2H3,(H,33,39)(H,34,35)(H,36,40)/t27-/m0/s1 |
| InChIKey | QWUGDAUMUOLJCG-MHZLTWQESA-N |
| XLogP | 5.89 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|