C30H38N4O2 — CID 44589633
1-methyl-N-[(1S)-7-oxo-1-[5-(4-phenylphenyl)-1H-imidazol-2-yl]octyl]piperidine-4-carboxamide (PubChem CID 44589633) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-7-oxo-1-[5-(4-phenylphenyl)-1H-imidazol-2-yl]octyl]piperidine-4-carboxamide.
| Compound Name | 1-methyl-N-[(1S)-7-oxo-1-[5-(4-phenylphenyl)-1H-imidazol-2-yl]octyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 44589633 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 1-methyl-N-[(1S)-7-oxo-1-[5-(4-phenylphenyl)-1H-imidazol-2-yl]octyl]piperidine-4-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C1CCN(C)CC1)c1ncc(-c2ccc(-c3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C30H38N4O2/c1-22(35)9-5-3-8-12-27(33-30(36)26-17-19-34(2)20-18-26)29-31-21-28(32-29)25-15-13-24(14-16-25)23-10-6-4-7-11-23/h4,6-7,10-11,13-16,21,26-27H,3,5,8-9,12,17-20H2,1-2H3,(H,31,32)(H,33,36)/t27-/m0/s1 |
| InChIKey | VFWKZLPTQCSNKW-MHZLTWQESA-N |
| XLogP | 5.78 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|