C22H29N5O3S — CID 87331947
1,2-dimethyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]imidazole-4-sulfonamide (PubChem CID 87331947) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 1,2-dimethyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]imidazole-4-sulfonamide.
| Compound Name | 1,2-dimethyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 87331947 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1,2-dimethyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]imidazole-4-sulfonamide |
| SMILES | CC(=O)CCCCC[C@H](NS(=O)(=O)c1cn(C)c(C)n1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H29N5O3S/c1-16(28)10-6-4-9-13-19(26-31(29,30)21-15-27(3)17(2)24-21)22-23-14-20(25-22)18-11-7-5-8-12-18/h5,7-8,11-12,14-15,19,26H,4,6,9-10,13H2,1-3H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | OXLOWFABBJXROX-IBGZPJMESA-N |
| XLogP | 3.68 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|