C28H39N5O2 — CID 141254987
2-(2,2-dimethylhydrazinyl)-2-methyl-N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]propanamide (PubChem CID 141254987) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-2-methyl-N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]propanamide.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-2-methyl-N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]propanamide |
|---|---|
| PubChem CID | 141254987 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-2-methyl-N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxononyl]propanamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C(C)(C)NN(C)C)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C28H39N5O2/c1-6-23(34)14-8-7-9-15-24(31-27(35)28(2,3)32-33(4)5)26-29-19-25(30-26)22-17-16-20-12-10-11-13-21(20)18-22/h10-13,16-19,24,32H,6-9,14-15H2,1-5H3,(H,29,30)(H,31,35)/t24-/m0/s1 |
| InChIKey | LNCVQINKLPYHCB-DEOSSOPVSA-N |
| XLogP | 5.16 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|