C31H35F3N4O3 — CID 87331495
2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]nonyl]acetamide (PubChem CID 87331495) has the molecular formula C31H35F3N4O3 and a molecular weight of 568.64 g/mol. Its IUPAC name is 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]nonyl]acetamide.
| Compound Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]nonyl]acetamide |
|---|---|
| PubChem CID | 87331495 |
| Molecular Formula | C31H35F3N4O3 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-7-oxo-1-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]nonyl]acetamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)Cc1c(C)[nH]c2ccc(OC)cc12)c1ncc(-c2ccc(C(F)(F)F)cc2)[nH]1 |
| InChI | InChI=1S/C31H35F3N4O3/c1-4-22(39)8-6-5-7-9-27(30-35-18-28(38-30)20-10-12-21(13-11-20)31(32,33)34)37-29(40)17-24-19(2)36-26-15-14-23(41-3)16-25(24)26/h10-16,18,27,36H,4-9,17H2,1-3H3,(H,35,38)(H,37,40)/t27-/m0/s1 |
| InChIKey | OPXAXJWCWMTRIX-MHZLTWQESA-N |
| XLogP | 7.22 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|