C30H36N4O3 — CID 67268443
2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[7-oxo-1-(3-phenyl-1H-pyrazol-5-yl)nonyl]acetamide (PubChem CID 67268443) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[7-oxo-1-(3-phenyl-1H-pyrazol-5-yl)nonyl]acetamide.
| Compound Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[7-oxo-1-(3-phenyl-1H-pyrazol-5-yl)nonyl]acetamide |
|---|---|
| PubChem CID | 67268443 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[7-oxo-1-(3-phenyl-1H-pyrazol-5-yl)nonyl]acetamide |
| SMILES | CCC(=O)CCCCCC(NC(=O)Cc1c(C)[nH]c2ccc(OC)cc12)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C30H36N4O3/c1-4-22(35)13-9-6-10-14-27(29-19-28(33-34-29)21-11-7-5-8-12-21)32-30(36)18-24-20(2)31-26-16-15-23(37-3)17-25(24)26/h5,7-8,11-12,15-17,19,27,31H,4,6,9-10,13-14,18H2,1-3H3,(H,32,36)(H,33,34) |
| InChIKey | AETGJBJQWNVJPS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|