C17H24F4N2O2Si — CID 151739550
[6-fluoro-7-(3,3,3-trifluoropropyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methanol (PubChem CID 151739550) has the molecular formula C17H24F4N2O2Si and a molecular weight of 392.47 g/mol. Its IUPAC name is [6-fluoro-7-(3,3,3-trifluoropropyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methanol.
| Compound Name | [6-fluoro-7-(3,3,3-trifluoropropyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 151739550 |
| Molecular Formula | C17H24F4N2O2Si |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [6-fluoro-7-(3,3,3-trifluoropropyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1c(CO)cc2ncc(F)c(CCC(F)(F)F)c21 |
| InChI | InChI=1S/C17H24F4N2O2Si/c1-26(2,3)7-6-25-11-23-12(10-24)8-15-16(23)13(14(18)9-22-15)4-5-17(19,20)21/h8-9,24H,4-7,10-11H2,1-3H3 |
| InChIKey | RMFXSHGRRCDQSA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|