C19H26ClN2O3Si- — CID 131736852
5-[3-chloro-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-2,4-dimethylbenzoate (PubChem CID 131736852) has the molecular formula C19H26ClN2O3Si- and a molecular weight of 393.97 g/mol. Its IUPAC name is 5-[3-chloro-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-2,4-dimethylbenzoate.
| Compound Name | 5-[3-chloro-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 131736852 |
| Molecular Formula | C19H26ClN2O3Si- |
| Molecular Weight | 393.97 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 5-[3-chloro-4-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-2,4-dimethylbenzoate |
| SMILES | Cc1cc(C)c(-c2c(C)c(Cl)nn2COCC[Si](C)(C)C)cc1C(=O)[O-] |
| InChI | InChI=1S/C19H27ClN2O3Si/c1-12-9-13(2)16(19(23)24)10-15(12)17-14(3)18(20)21-22(17)11-25-7-8-26(4,5)6/h9-10H,7-8,11H2,1-6H3,(H,23,24)/p-1 |
| InChIKey | JMRIWNMRKMKGMG-UHFFFAOYSA-M |
| XLogP | 3.80 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.97 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|