C18H27ClN6O4Si — CID 171630150
3-[5-chloro-4-nitro-2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-5-morpholin-4-ylpyridin-2-amine (PubChem CID 171630150) has the molecular formula C18H27ClN6O4Si and a molecular weight of 454.99 g/mol. Its IUPAC name is 3-[5-chloro-4-nitro-2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-5-morpholin-4-ylpyridin-2-amine.
| Compound Name | 3-[5-chloro-4-nitro-2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-5-morpholin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 171630150 |
| Molecular Formula | C18H27ClN6O4Si |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 3-[5-chloro-4-nitro-2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-5-morpholin-4-ylpyridin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1nc(Cl)c([N+](=O)[O-])c1-c1cc(N2CCOCC2)cnc1N |
| InChI | InChI=1S/C18H27ClN6O4Si/c1-30(2,3)9-8-29-12-24-15(16(25(26)27)17(19)22-24)14-10-13(11-21-18(14)20)23-4-6-28-7-5-23/h10-11H,4-9,12H2,1-3H3,(H2,20,21) |
| InChIKey | QPPQRWWLHOVNNP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|