C24H38N6O6Si — CID 171630167
tert-butyl N-[4-[3-methyl-4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-6-morpholin-4-yl-3-pyridinyl]carbamate (PubChem CID 171630167) has the molecular formula C24H38N6O6Si and a molecular weight of 534.69 g/mol. Its IUPAC name is tert-butyl N-[4-[3-methyl-4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-6-morpholin-4-yl-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-methyl-4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-6-morpholin-4-yl-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 171630167 |
| Molecular Formula | C24H38N6O6Si |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | tert-butyl N-[4-[3-methyl-4-nitro-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-6-morpholin-4-yl-3-pyridinyl]carbamate |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(-c2cc(N3CCOCC3)ncc2NC(=O)OC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H38N6O6Si/c1-17-21(30(32)33)22(29(27-17)16-35-12-13-37(5,6)7)18-14-20(28-8-10-34-11-9-28)25-15-19(18)26-23(31)36-24(2,3)4/h14-15H,8-13,16H2,1-7H3,(H,26,31) |
| InChIKey | BEZYSMXUFGLJHV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|