C28H41Br3N6O2S2Si2 — CID 158795627
benzenethiol;2-[(3-bromo-5-phenylsulfanyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane;2-[(3,5-dibromo-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 158795627) has the molecular formula C28H41Br3N6O2S2Si2 and a molecular weight of 853.69 g/mol. Its IUPAC name is benzenethiol;2-[(3-bromo-5-phenylsulfanyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane;2-[(3,5-dibromo-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | benzenethiol;2-[(3-bromo-5-phenylsulfanyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane;2-[(3,5-dibromo-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 158795627 |
| Molecular Formula | C28H41Br3N6O2S2Si2 |
| Molecular Weight | 853.69 g/mol |
| Exact Mass | 849.98 |
| IUPAC Name | benzenethiol;2-[(3-bromo-5-phenylsulfanyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane;2-[(3,5-dibromo-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)nc1Br.C[Si](C)(C)CCOCn1nc(Br)nc1Sc1ccccc1.Sc1ccccc1 |
| InChI | InChI=1S/C14H20BrN3OSSi.C8H15Br2N3OSi.C6H6S/c1-21(2,3)10-9-19-11-18-14(16-13(15)17-18)20-12-7-5-4-6-8-12;1-15(2,3)5-4-14-6-13-8(10)11-7(9)12-13;7-6-4-2-1-3-5-6/h4-8H,9-11H2,1-3H3;4-6H2,1-3H3;1-5,7H |
| InChIKey | ISVDHHYGISXKRD-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.69 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|