C21H30N2OSSi — CID 53359482
trimethyl-[2-[[5-(2-methylidenecyclopentyl)-2-phenylsulfanylimidazol-1-yl]methoxy]ethyl]silane (PubChem CID 53359482) has the molecular formula C21H30N2OSSi and a molecular weight of 386.64 g/mol. Its IUPAC name is trimethyl-[2-[[5-(2-methylidenecyclopentyl)-2-phenylsulfanylimidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-(2-methylidenecyclopentyl)-2-phenylsulfanylimidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 53359482 |
| Molecular Formula | C21H30N2OSSi |
| Molecular Weight | 386.64 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | trimethyl-[2-[[5-(2-methylidenecyclopentyl)-2-phenylsulfanylimidazol-1-yl]methoxy]ethyl]silane |
| SMILES | C=C1CCCC1c1cnc(Sc2ccccc2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H30N2OSSi/c1-17-9-8-12-19(17)20-15-22-21(25-18-10-6-5-7-11-18)23(20)16-24-13-14-26(2,3)4/h5-7,10-11,15,19H,1,8-9,12-14,16H2,2-4H3 |
| InChIKey | RRZIKWKVAHPHAL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|