C23H32N4O2SSi — CID 23652391
N-[3-(2-phenylsulfanyl-1H-imidazol-5-yl)propyl]-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide (PubChem CID 23652391) has the molecular formula C23H32N4O2SSi and a molecular weight of 456.69 g/mol. Its IUPAC name is N-[3-(2-phenylsulfanyl-1H-imidazol-5-yl)propyl]-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide.
| Compound Name | N-[3-(2-phenylsulfanyl-1H-imidazol-5-yl)propyl]-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 23652391 |
| Molecular Formula | C23H32N4O2SSi |
| Molecular Weight | 456.69 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-[3-(2-phenylsulfanyl-1H-imidazol-5-yl)propyl]-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cccc1C(=O)NCCCc1cnc(Sc2ccccc2)[nH]1 |
| InChI | InChI=1S/C23H32N4O2SSi/c1-31(2,3)16-15-29-18-27-14-8-12-21(27)22(28)24-13-7-9-19-17-25-23(26-19)30-20-10-5-4-6-11-20/h4-6,8,10-12,14,17H,7,9,13,15-16,18H2,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | VZFXWSWUPOHXKX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|