C25H35Br2N5O4S2Si — CID 23650304
4,5-dibromo-N-[3-[3-(dimethylsulfamoyl)-2-phenylsulfanylimidazol-4-yl]propyl]-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide (PubChem CID 23650304) has the molecular formula C25H35Br2N5O4S2Si and a molecular weight of 721.61 g/mol. Its IUPAC name is 4,5-dibromo-N-[3-[3-(dimethylsulfamoyl)-2-phenylsulfanylimidazol-4-yl]propyl]-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[3-[3-(dimethylsulfamoyl)-2-phenylsulfanylimidazol-4-yl]propyl]-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 23650304 |
| Molecular Formula | C25H35Br2N5O4S2Si |
| Molecular Weight | 721.61 g/mol |
| Exact Mass | 719.03 |
| IUPAC Name | 4,5-dibromo-N-[3-[3-(dimethylsulfamoyl)-2-phenylsulfanylimidazol-4-yl]propyl]-1-(2-trimethylsilylethoxymethyl)pyrrole-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)n1c(CCCNC(=O)c2cc(Br)c(Br)n2COCC[Si](C)(C)C)cnc1Sc1ccccc1 |
| InChI | InChI=1S/C25H35Br2N5O4S2Si/c1-30(2)38(34,35)32-19(17-29-25(32)37-20-11-7-6-8-12-20)10-9-13-28-24(33)22-16-21(26)23(27)31(22)18-36-14-15-39(3,4)5/h6-8,11-12,16-17H,9-10,13-15,18H2,1-5H3,(H,28,33) |
| InChIKey | YLIYNWYKWUITBT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|