C19H27N3O3S2 — CID 38570369
4-(diethylsulfamoyl)-1-methyl-N-(3-phenylsulfanylpropyl)pyrrole-2-carboxamide (PubChem CID 38570369) has the molecular formula C19H27N3O3S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-1-methyl-N-(3-phenylsulfanylpropyl)pyrrole-2-carboxamide.
| Compound Name | 4-(diethylsulfamoyl)-1-methyl-N-(3-phenylsulfanylpropyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 38570369 |
| Molecular Formula | C19H27N3O3S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-(diethylsulfamoyl)-1-methyl-N-(3-phenylsulfanylpropyl)pyrrole-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCCCSc2ccccc2)n(C)c1 |
| InChI | InChI=1S/C19H27N3O3S2/c1-4-22(5-2)27(24,25)17-14-18(21(3)15-17)19(23)20-12-9-13-26-16-10-7-6-8-11-16/h6-8,10-11,14-15H,4-5,9,12-13H2,1-3H3,(H,20,23) |
| InChIKey | IKEGYHXANQZNQB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|