C17H32N4O3S — CID 46480322
N-[2-(diethylamino)propyl]-4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxamide (PubChem CID 46480322) has the molecular formula C17H32N4O3S and a molecular weight of 372.54 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-(diethylamino)propyl]-4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46480322 |
| Molecular Formula | C17H32N4O3S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[2-(diethylamino)propyl]-4-(diethylsulfamoyl)-1-methylpyrrole-2-carboxamide |
| SMILES | CCN(CC)C(C)CNC(=O)c1cc(S(=O)(=O)N(CC)CC)cn1C |
| InChI | InChI=1S/C17H32N4O3S/c1-7-20(8-2)14(5)12-18-17(22)16-11-15(13-19(16)6)25(23,24)21(9-3)10-4/h11,13-14H,7-10,12H2,1-6H3,(H,18,22) |
| InChIKey | WZUWAWMHGVSOAY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |