C12H19N3O5S — CID 60732233
4-[ethyl-[2-(ethylamino)-2-oxoethyl]sulfamoyl]-1-methylpyrrole-2-carboxylic acid (PubChem CID 60732233) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-[ethyl-[2-(ethylamino)-2-oxoethyl]sulfamoyl]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[ethyl-[2-(ethylamino)-2-oxoethyl]sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 60732233 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[ethyl-[2-(ethylamino)-2-oxoethyl]sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
| SMILES | CCNC(=O)CN(CC)S(=O)(=O)c1cc(C(=O)O)n(C)c1 |
| InChI | InChI=1S/C12H19N3O5S/c1-4-13-11(16)8-15(5-2)21(19,20)9-6-10(12(17)18)14(3)7-9/h6-7H,4-5,8H2,1-3H3,(H,13,16)(H,17,18) |
| InChIKey | DACRGMURDYIOQF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |